C29H36O15S — CID 102240588
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 102240588) has the molecular formula C29H36O15S and a molecular weight of 656.66 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102240588 |
| Molecular Formula | C29H36O15S |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-phenylsulfanyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2CO[C@@H](Sc3ccccc3)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H36O15S/c1-14(30)36-12-21-23(38-15(2)31)25(40-17(4)33)26(41-18(5)34)28(43-21)44-22-13-37-29(45-20-10-8-7-9-11-20)27(42-19(6)35)24(22)39-16(3)32/h7-11,21-29H,12-13H2,1-6H3/t21-,22-,23-,24+,25+,26-,27-,28+,29+/m1/s1 |
| InChIKey | IOHDMEVZKWYGRC-DSBUHQCDSA-N |
| XLogP | 1.47 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|