C23H22N2O4S — CID 10224059
methyl sulfate;8,11,20-trimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2,4,6,9,11,13(21),14,16,18-decaene (PubChem CID 10224059) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is methyl sulfate;8,11,20-trimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2,4,6,9,11,13(21),14,16,18-decaene.
| Compound Name | methyl sulfate;8,11,20-trimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2,4,6,9,11,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 10224059 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | methyl sulfate;8,11,20-trimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2,4,6,9,11,13(21),14,16,18-decaene |
| SMILES | COS(=O)(=O)[O-].Cc1cc2c3c([n+](C)c4ccccc4c3c1)-c1ccccc1N2C |
| InChI | InChI=1S/C22H19N2.CH4O4S/c1-14-12-17-15-8-4-6-10-18(15)24(3)22-16-9-5-7-11-19(16)23(2)20(13-14)21(17)22;1-5-6(2,3)4/h4-13H,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | WWVVNCOSIYUXGM-UHFFFAOYSA-M |
| XLogP | 3.97 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|