5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride

C21H20ClN3 — CID 11765

IUPAC5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride
SMILESCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[Cl-]
InChIInChI=1S/C21H19N3.ClH/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,23H,2,22H2,1H3;1H
InChIKeyBITVSRNAFFZUFW-UHFFFAOYSA-N
MW349.87 g/mol
LogP1.14
Rot. Bonds2

About 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride

5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride (PubChem CID 11765) has the molecular formula C21H20ClN3 and a molecular weight of 349.87 g/mol. Its IUPAC name is 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride.

Molecular Properties

Compound Name5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride
PubChem CID11765
Molecular FormulaC21H20ClN3
Molecular Weight349.87 g/mol
Exact Mass349.13
IUPAC Name5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride
SMILESCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[Cl-]
InChIInChI=1S/C21H19N3.ClH/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,23H,2,22H2,1H3;1H
InChIKeyBITVSRNAFFZUFW-UHFFFAOYSA-N
XLogP1.14
TPSA55.92 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500349.87
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride?
The IUPAC name of 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride (CID 11765) is 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride.
What is the SMILES notation for 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride?
The canonical SMILES for 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride is CC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[Cl-].
What is the InChIKey of 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride?
The InChIKey is BITVSRNAFFZUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3.ClH/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,23H,2,22H2,1H3;1H.
What are the key properties of 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride?
5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride has a molecular weight of 349.87 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine chloride is sourced from PubChem (CID 11765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).