C15H17ClN4 — CID 11105
8-N,8-N,3-trimethylphenazine-2,8-diamine;hydrochloride (PubChem CID 11105) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is 8-N,8-N,3-trimethylphenazine-2,8-diamine;hydrochloride.
| Compound Name | 8-N,8-N,3-trimethylphenazine-2,8-diamine;hydrochloride |
|---|---|
| PubChem CID | 11105 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 8-N,8-N,3-trimethylphenazine-2,8-diamine;hydrochloride |
| SMILES | Cc1cc2nc3ccc(N(C)C)cc3nc2cc1N.Cl |
| InChI | InChI=1S/C15H16N4.ClH/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H |
| InChIKey | PGSADBUBUOPOJS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|