C14H18O4 — CID 102240682
ethyl 6,6-dimethyl-2-methylidene-4-oxo-5,7-dihydro-3H-1-benzofuran-5-carboxylate (PubChem CID 102240682) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl 6,6-dimethyl-2-methylidene-4-oxo-5,7-dihydro-3H-1-benzofuran-5-carboxylate.
| Compound Name | ethyl 6,6-dimethyl-2-methylidene-4-oxo-5,7-dihydro-3H-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 102240682 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl 6,6-dimethyl-2-methylidene-4-oxo-5,7-dihydro-3H-1-benzofuran-5-carboxylate |
| SMILES | C=C1CC2=C(CC(C)(C)C(C(=O)OCC)C2=O)O1 |
| InChI | InChI=1S/C14H18O4/c1-5-17-13(16)11-12(15)9-6-8(2)18-10(9)7-14(11,3)4/h11H,2,5-7H2,1,3-4H3 |
| InChIKey | JVBCENTWISXXPO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|