C15H24O — CID 102242688
(4aS,6S,9aR)-1,6,9,9-tetramethyl-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulen-5-one (PubChem CID 102242688) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (4aS,6S,9aR)-1,6,9,9-tetramethyl-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulen-5-one.
| Compound Name | (4aS,6S,9aR)-1,6,9,9-tetramethyl-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulen-5-one |
|---|---|
| PubChem CID | 102242688 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (4aS,6S,9aR)-1,6,9,9-tetramethyl-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulen-5-one |
| SMILES | CC1=CCC[C@@H]2C(=O)[C@@H](C)CCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C15H24O/c1-10-6-5-7-12-13(10)15(3,4)9-8-11(2)14(12)16/h6,11-13H,5,7-9H2,1-4H3/t11-,12-,13+/m0/s1 |
| InChIKey | LAXQAHCVHFVRLD-RWMBFGLXSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|