C13H18O3 — CID 102243080
(3aR,8aS,8bR)-8a-hydroxy-8,8-dimethyl-3,3a,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one (PubChem CID 102243080) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3aR,8aS,8bR)-8a-hydroxy-8,8-dimethyl-3,3a,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one.
| Compound Name | (3aR,8aS,8bR)-8a-hydroxy-8,8-dimethyl-3,3a,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one |
|---|---|
| PubChem CID | 102243080 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3aR,8aS,8bR)-8a-hydroxy-8,8-dimethyl-3,3a,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one |
| SMILES | CC1(C)CCCC2=C[C@H]3CC(=O)O[C@H]3[C@@]21O |
| InChI | InChI=1S/C13H18O3/c1-12(2)5-3-4-9-6-8-7-10(14)16-11(8)13(9,12)15/h6,8,11,15H,3-5,7H2,1-2H3/t8-,11+,13-/m0/s1 |
| InChIKey | ZGUFINPKTJPYSD-KDDOJWQBSA-N |
| XLogP | 1.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|