C20H22O5 — CID 143088481
(1R,8S,9E,13S)-2,2-dimethyl-9-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-12-oxatetracyclo[6.4.1.01,6.010,13]tridec-6-en-11-one (PubChem CID 143088481) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (1R,8S,9E,13S)-2,2-dimethyl-9-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-12-oxatetracyclo[6.4.1.01,6.010,13]tridec-6-en-11-one.
| Compound Name | (1R,8S,9E,13S)-2,2-dimethyl-9-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-12-oxatetracyclo[6.4.1.01,6.010,13]tridec-6-en-11-one |
|---|---|
| PubChem CID | 143088481 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (1R,8S,9E,13S)-2,2-dimethyl-9-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-12-oxatetracyclo[6.4.1.01,6.010,13]tridec-6-en-11-one |
| SMILES | CC1=C[C@H](O/C=C2/C3C(=O)O[C@]45C(=C[C@H]2[C@@H]34)CCCC5(C)C)OC1=O |
| InChI | InChI=1S/C20H22O5/c1-10-7-14(24-17(10)21)23-9-13-12-8-11-5-4-6-19(2,3)20(11)16(12)15(13)18(22)25-20/h7-9,12,14-16H,4-6H2,1-3H3/b13-9+/t12-,14-,15?,16+,20-/m1/s1 |
| InChIKey | YFHMWPDRGVMWKH-GHROLRGZSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|