C22H28O5 — CID 163663088
(1S,2S,10S,13Z)-2,6,6-trimethyl-13-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-11-oxatetracyclo[8.3.1.01,10.02,7]tetradecan-12-one (PubChem CID 163663088) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (1S,2S,10S,13Z)-2,6,6-trimethyl-13-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-11-oxatetracyclo[8.3.1.01,10.02,7]tetradecan-12-one.
| Compound Name | (1S,2S,10S,13Z)-2,6,6-trimethyl-13-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-11-oxatetracyclo[8.3.1.01,10.02,7]tetradecan-12-one |
|---|---|
| PubChem CID | 163663088 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (1S,2S,10S,13Z)-2,6,6-trimethyl-13-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-11-oxatetracyclo[8.3.1.01,10.02,7]tetradecan-12-one |
| SMILES | CC1=C[C@H](O/C=C2\C(=O)O[C@]34CCC5C(C)(C)CCC[C@]5(C)[C@@]23C4)OC1=O |
| InChI | InChI=1S/C22H28O5/c1-13-10-16(26-17(13)23)25-11-14-18(24)27-21-9-6-15-19(2,3)7-5-8-20(15,4)22(14,21)12-21/h10-11,15-16H,5-9,12H2,1-4H3/b14-11+/t15?,16-,20+,21+,22-/m1/s1 |
| InChIKey | IWBLNQWCNOSSNQ-ISLINBSYSA-N |
| XLogP | 4.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|