C21H28O6 — CID 143118726
(3E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4-methyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxan-2-one (PubChem CID 143118726) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (3E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4-methyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxan-2-one.
| Compound Name | (3E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4-methyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxan-2-one |
|---|---|
| PubChem CID | 143118726 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3E)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4-methyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxan-2-one |
| SMILES | CC1=CC(O/C=C2/C(=O)OCC(C3=C(C)C(O)CCC3(C)C)C2C)OC1=O |
| InChI | InChI=1S/C21H28O6/c1-11-8-17(27-19(11)23)25-10-15-12(2)14(9-26-20(15)24)18-13(3)16(22)6-7-21(18,4)5/h8,10,12,14,16-17,22H,6-7,9H2,1-5H3/b15-10+ |
| InChIKey | FRPMCHKSRYZJMB-XNTDXEJSSA-N |
| XLogP | 3.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|