C23H32O4 — CID 118406301
(1Z,3aR,9aS,9bS)-3a,6,6,9a-tetramethyl-1-[[(2S)-4-methyl-5-methylidene-2H-furan-2-yl]oxymethylidene]-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran-2-one (PubChem CID 118406301) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1Z,3aR,9aS,9bS)-3a,6,6,9a-tetramethyl-1-[[(2S)-4-methyl-5-methylidene-2H-furan-2-yl]oxymethylidene]-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran-2-one.
| Compound Name | (1Z,3aR,9aS,9bS)-3a,6,6,9a-tetramethyl-1-[[(2S)-4-methyl-5-methylidene-2H-furan-2-yl]oxymethylidene]-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 118406301 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1Z,3aR,9aS,9bS)-3a,6,6,9a-tetramethyl-1-[[(2S)-4-methyl-5-methylidene-2H-furan-2-yl]oxymethylidene]-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran-2-one |
| SMILES | C=C1O[C@H](O/C=C2\C(=O)O[C@]3(C)CCC4C(C)(C)CCC[C@]4(C)[C@@H]23)C=C1C |
| InChI | InChI=1S/C23H32O4/c1-14-12-18(26-15(14)2)25-13-16-19-22(5)10-7-9-21(3,4)17(22)8-11-23(19,6)27-20(16)24/h12-13,17-19H,2,7-11H2,1,3-6H3/b16-13-/t17?,18-,19+,22-,23+/m0/s1 |
| InChIKey | NNACZKVIJGLFGM-QKLVKNLASA-N |
| XLogP | 5.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|