C24H34O5 — CID 135285176
(1E,3aR,5aS,9aR,9bS)-1-[(3,4-dimethyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3a,5a,6,6,9a-pentamethyl-4,5,7,8,9,9b-hexahydrobenzo[e][1]benzofuran-2-one (PubChem CID 135285176) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (1E,3aR,5aS,9aR,9bS)-1-[(3,4-dimethyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3a,5a,6,6,9a-pentamethyl-4,5,7,8,9,9b-hexahydrobenzo[e][1]benzofuran-2-one.
| Compound Name | (1E,3aR,5aS,9aR,9bS)-1-[(3,4-dimethyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3a,5a,6,6,9a-pentamethyl-4,5,7,8,9,9b-hexahydrobenzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 135285176 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (1E,3aR,5aS,9aR,9bS)-1-[(3,4-dimethyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3a,5a,6,6,9a-pentamethyl-4,5,7,8,9,9b-hexahydrobenzo[e][1]benzofuran-2-one |
| SMILES | CC1=C(C)C(O/C=C2/C(=O)O[C@]3(C)CC[C@@]4(C)C(C)(C)CCC[C@]4(C)[C@@H]23)OC1=O |
| InChI | InChI=1S/C24H34O5/c1-14-15(2)20(28-18(14)25)27-13-16-17-22(5)10-8-9-21(3,4)24(22,7)12-11-23(17,6)29-19(16)26/h13,17,20H,8-12H2,1-7H3/b16-13+/t17-,20?,22-,23-,24+/m1/s1 |
| InChIKey | KWZQTSUUSBHPJT-CRSGSQMWSA-N |
| XLogP | 5.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|