C21H34O — CID 157170583
(1Z,3aS,5aR,9aR,9bR)-3a,6,6,9a-tetramethyl-2-methylidene-1-(2-methylpropylidene)-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran (PubChem CID 157170583) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (1Z,3aS,5aR,9aR,9bR)-3a,6,6,9a-tetramethyl-2-methylidene-1-(2-methylpropylidene)-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran.
| Compound Name | (1Z,3aS,5aR,9aR,9bR)-3a,6,6,9a-tetramethyl-2-methylidene-1-(2-methylpropylidene)-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran |
|---|---|
| PubChem CID | 157170583 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (1Z,3aS,5aR,9aR,9bR)-3a,6,6,9a-tetramethyl-2-methylidene-1-(2-methylpropylidene)-5,5a,7,8,9,9b-hexahydro-4H-benzo[e][1]benzofuran |
| SMILES | C=C1O[C@@]2(C)CC[C@@H]3C(C)(C)CCC[C@@]3(C)[C@@H]2/C1=C/C(C)C |
| InChI | InChI=1S/C21H34O/c1-14(2)13-16-15(3)22-21(7)12-9-17-19(4,5)10-8-11-20(17,6)18(16)21/h13-14,17-18H,3,8-12H2,1-2,4-7H3/b16-13+/t17-,18+,20-,21+/m1/s1 |
| InChIKey | PHDJEBCITCGVOL-SUCHKRATSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |