C21H28O3 — CID 91935540
(4aS,6aS,12aR,12bS)-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,11,12a-octahydrobenzo[a]xanthene-9,10-dione (PubChem CID 91935540) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (4aS,6aS,12aR,12bS)-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,11,12a-octahydrobenzo[a]xanthene-9,10-dione.
| Compound Name | (4aS,6aS,12aR,12bS)-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,11,12a-octahydrobenzo[a]xanthene-9,10-dione |
|---|---|
| PubChem CID | 91935540 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (4aS,6aS,12aR,12bS)-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6,11,12a-octahydrobenzo[a]xanthene-9,10-dione |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3C=C4CC(=O)C(=O)C=C4O[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O3/c1-19(2)7-5-8-20(3)17(19)6-9-21(4)18(20)11-13-10-14(22)15(23)12-16(13)24-21/h11-12,17-18H,5-10H2,1-4H3/t17-,18+,20-,21-/m0/s1 |
| InChIKey | OHNKHVXVPKMGCI-YHELAOLJSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|