C22H30O3 — CID 22297841
(4aR,6aR,12aS,12bR)-10-methoxy-4,4,6a,12b-tetramethyl-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-9-one (PubChem CID 22297841) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (4aR,6aR,12aS,12bR)-10-methoxy-4,4,6a,12b-tetramethyl-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-9-one.
| Compound Name | (4aR,6aR,12aS,12bR)-10-methoxy-4,4,6a,12b-tetramethyl-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-9-one |
|---|---|
| PubChem CID | 22297841 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (4aR,6aR,12aS,12bR)-10-methoxy-4,4,6a,12b-tetramethyl-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-9-one |
| SMILES | COC1=CC2=C[C@H]3[C@]4(C)CCCC(C)(C)[C@H]4CC[C@@]3(C)OC2=CC1=O |
| InChI | InChI=1S/C22H30O3/c1-20(2)8-6-9-21(3)18(20)7-10-22(4)19(21)12-14-11-17(24-5)15(23)13-16(14)25-22/h11-13,18-19H,6-10H2,1-5H3/t18-,19+,21-,22-/m1/s1 |
| InChIKey | ZBJMJNFORKVCHU-NPDDRXJXSA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |