C24H32O4 — CID 15887259
[(4aS,6aS,12aR,12bR)-4,4,6a,9,12b-pentamethyl-12-oxo-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-11-yl] acetate (PubChem CID 15887259) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(4aS,6aS,12aR,12bR)-4,4,6a,9,12b-pentamethyl-12-oxo-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-11-yl] acetate.
| Compound Name | [(4aS,6aS,12aR,12bR)-4,4,6a,9,12b-pentamethyl-12-oxo-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-11-yl] acetate |
|---|---|
| PubChem CID | 15887259 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(4aS,6aS,12aR,12bR)-4,4,6a,9,12b-pentamethyl-12-oxo-2,3,4a,5,6,12a-hexahydro-1H-benzo[a]xanthen-11-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)cc2c1C(=O)[C@@H]1[C@]3(C)CCCC(C)(C)[C@@H]3CC[C@]1(C)O2 |
| InChI | InChI=1S/C24H32O4/c1-14-12-16(27-15(2)25)19-17(13-14)28-24(6)11-8-18-22(3,4)9-7-10-23(18,5)21(24)20(19)26/h12-13,18,21H,7-11H2,1-6H3/t18-,21+,23+,24-/m0/s1 |
| InChIKey | NHIPNSHYWOZPTN-DAQNBYSMSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|