C24H34O5 — CID 10763647
[2-[(3R,4aS,10aR,10bR)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-4-methoxyphenyl] acetate (PubChem CID 10763647) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [2-[(3R,4aS,10aR,10bR)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-4-methoxyphenyl] acetate.
| Compound Name | [2-[(3R,4aS,10aR,10bR)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-4-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 10763647 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [2-[(3R,4aS,10aR,10bR)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-4-methoxyphenyl] acetate |
| SMILES | COc1ccc(OC(C)=O)c([C@@H]2OC[C@@H]3[C@H](CCC4C(C)(C)CCC[C@]43C)O2)c1 |
| InChI | InChI=1S/C24H34O5/c1-15(25)28-19-8-7-16(26-5)13-17(19)22-27-14-18-20(29-22)9-10-21-23(2,3)11-6-12-24(18,21)4/h7-8,13,18,20-22H,6,9-12,14H2,1-5H3/t18-,20+,21?,22-,24+/m1/s1 |
| InChIKey | DQFSTRMYUGFJHI-ZEVIYNSISA-N |
| XLogP | 5.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|