C24H33NO7 — CID 10718279
[2-[(3S,4aR,10aS,10bS)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-6-methoxy-4-nitrophenyl] acetate (PubChem CID 10718279) has the molecular formula C24H33NO7 and a molecular weight of 447.53 g/mol. Its IUPAC name is [2-[(3S,4aR,10aS,10bS)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-6-methoxy-4-nitrophenyl] acetate.
| Compound Name | [2-[(3S,4aR,10aS,10bS)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-6-methoxy-4-nitrophenyl] acetate |
|---|---|
| PubChem CID | 10718279 |
| Molecular Formula | C24H33NO7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [2-[(3S,4aR,10aS,10bS)-7,7,10a-trimethyl-4a,5,6,6a,8,9,10,10b-octahydro-1H-naphtho[2,1-d][1,3]dioxin-3-yl]-6-methoxy-4-nitrophenyl] acetate |
| SMILES | COc1cc([N+](=O)[O-])cc([C@H]2OC[C@H]3[C@@H](CCC4C(C)(C)CCC[C@@]43C)O2)c1OC(C)=O |
| InChI | InChI=1S/C24H33NO7/c1-14(26)31-21-16(11-15(25(27)28)12-19(21)29-5)22-30-13-17-18(32-22)7-8-20-23(2,3)9-6-10-24(17,20)4/h11-12,17-18,20,22H,6-10,13H2,1-5H3/t17-,18+,20?,22-,24+/m0/s1 |
| InChIKey | FMXJQOZMNVEVER-CQQCQHKFSA-N |
| XLogP | 5.19 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|