C11H11ClF2N2O6 — CID 171188876
(4R)-5,5-difluoro-4-(2-hydroxy-3-methoxy-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171188876) has the molecular formula C11H11ClF2N2O6 and a molecular weight of 340.67 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(2-hydroxy-3-methoxy-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-5,5-difluoro-4-(2-hydroxy-3-methoxy-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171188876 |
| Molecular Formula | C11H11ClF2N2O6 |
| Molecular Weight | 340.67 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (4R)-5,5-difluoro-4-(2-hydroxy-3-methoxy-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | COc1cc([N+](=O)[O-])cc([C@H]2NC(=O)OCC2(F)F)c1O.Cl |
| InChI | InChI=1S/C11H10F2N2O6.ClH/c1-20-7-3-5(15(18)19)2-6(8(7)16)9-11(12,13)4-21-10(17)14-9;/h2-3,9,16H,4H2,1H3,(H,14,17);1H/t9-;/m1./s1 |
| InChIKey | CHUOXZMKCGUCNV-SBSPUUFOSA-N |
| XLogP | 2.15 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|