C10H9ClF2N2O5 — CID 171187726
(4R)-5,5-difluoro-4-(4-hydroxy-3-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187726) has the molecular formula C10H9ClF2N2O5 and a molecular weight of 310.64 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(4-hydroxy-3-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-5,5-difluoro-4-(4-hydroxy-3-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171187726 |
| Molecular Formula | C10H9ClF2N2O5 |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (4R)-5,5-difluoro-4-(4-hydroxy-3-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@H](c2ccc(O)c([N+](=O)[O-])c2)C(F)(F)CO1 |
| InChI | InChI=1S/C10H8F2N2O5.ClH/c11-10(12)4-19-9(16)13-8(10)5-1-2-7(15)6(3-5)14(17)18;/h1-3,8,15H,4H2,(H,13,16);1H/t8-;/m1./s1 |
| InChIKey | RNUCWAUFEJOSJR-DDWIOCJRSA-N |
| XLogP | 2.14 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|