C10H9F2NO3 — CID 171186128
(4S)-5,5-difluoro-4-(4-hydroxyphenyl)-1,3-oxazinan-2-one (PubChem CID 171186128) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is (4S)-5,5-difluoro-4-(4-hydroxyphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4S)-5,5-difluoro-4-(4-hydroxyphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171186128 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | (4S)-5,5-difluoro-4-(4-hydroxyphenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@@H](c2ccc(O)cc2)C(F)(F)CO1 |
| InChI | InChI=1S/C10H9F2NO3/c11-10(12)5-16-9(15)13-8(10)6-1-3-7(14)4-2-6/h1-4,8,14H,5H2,(H,13,15)/t8-/m0/s1 |
| InChIKey | XKKPKRVNRHLYHJ-QMMMGPOBSA-N |
| XLogP | 1.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |