C11H10ClF2NO4 — CID 171187582
4-[(4R)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]benzoic acid;hydrochloride (PubChem CID 171187582) has the molecular formula C11H10ClF2NO4 and a molecular weight of 293.65 g/mol. Its IUPAC name is 4-[(4R)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]benzoic acid;hydrochloride.
| Compound Name | 4-[(4R)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171187582 |
| Molecular Formula | C11H10ClF2NO4 |
| Molecular Weight | 293.65 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 4-[(4R)-5,5-difluoro-2-oxo-1,3-oxazinan-4-yl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C1N[C@H](c2ccc(C(=O)O)cc2)C(F)(F)CO1 |
| InChI | InChI=1S/C11H9F2NO4.ClH/c12-11(13)5-18-10(17)14-8(11)6-1-3-7(4-2-6)9(15)16;/h1-4,8H,5H2,(H,14,17)(H,15,16);1H/t8-;/m1./s1 |
| InChIKey | QKTGJERZNLZCCZ-DDWIOCJRSA-N |
| XLogP | 2.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |