C10H7ClF2N2O4 — CID 171188239
(4R)-4-(4-chloro-3-nitrophenyl)-5,5-difluoro-1,3-oxazinan-2-one (PubChem CID 171188239) has the molecular formula C10H7ClF2N2O4 and a molecular weight of 292.63 g/mol. Its IUPAC name is (4R)-4-(4-chloro-3-nitrophenyl)-5,5-difluoro-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(4-chloro-3-nitrophenyl)-5,5-difluoro-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171188239 |
| Molecular Formula | C10H7ClF2N2O4 |
| Molecular Weight | 292.63 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (4R)-4-(4-chloro-3-nitrophenyl)-5,5-difluoro-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@H](c2ccc(Cl)c([N+](=O)[O-])c2)C(F)(F)CO1 |
| InChI | InChI=1S/C10H7ClF2N2O4/c11-6-2-1-5(3-7(6)15(17)18)8-10(12,13)4-19-9(16)14-8/h1-3,8H,4H2,(H,14,16)/t8-/m1/s1 |
| InChIKey | SPWZIQDAPPMPDE-MRVPVSSYSA-N |
| XLogP | 2.66 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|