C10H8F2N2O5 — CID 171187509
(4R)-5,5-difluoro-4-(2-hydroxy-5-nitrophenyl)-1,3-oxazinan-2-one (PubChem CID 171187509) has the molecular formula C10H8F2N2O5 and a molecular weight of 274.18 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(2-hydroxy-5-nitrophenyl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-5,5-difluoro-4-(2-hydroxy-5-nitrophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187509 |
| Molecular Formula | C10H8F2N2O5 |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (4R)-5,5-difluoro-4-(2-hydroxy-5-nitrophenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@H](c2cc([N+](=O)[O-])ccc2O)C(F)(F)CO1 |
| InChI | InChI=1S/C10H8F2N2O5/c11-10(12)4-19-9(16)13-8(10)6-3-5(14(17)18)1-2-7(6)15/h1-3,8,15H,4H2,(H,13,16)/t8-/m1/s1 |
| InChIKey | YJYDGROEYFJIDQ-MRVPVSSYSA-N |
| XLogP | 1.72 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|