C10H10ClF2NO3 — CID 171187816
(4R)-5,5-difluoro-4-(2-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187816) has the molecular formula C10H10ClF2NO3 and a molecular weight of 265.64 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(2-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-5,5-difluoro-4-(2-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171187816 |
| Molecular Formula | C10H10ClF2NO3 |
| Molecular Weight | 265.64 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | (4R)-5,5-difluoro-4-(2-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@H](c2ccccc2O)C(F)(F)CO1 |
| InChI | InChI=1S/C10H9F2NO3.ClH/c11-10(12)5-16-9(15)13-8(10)6-3-1-2-4-7(6)14;/h1-4,8,14H,5H2,(H,13,15);1H/t8-;/m1./s1 |
| InChIKey | BMZAPYGOOHXJHU-DDWIOCJRSA-N |
| XLogP | 2.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.64 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|