C12H14ClF2NO4 — CID 171188868
(4R)-4-(3-ethoxy-2-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171188868) has the molecular formula C12H14ClF2NO4 and a molecular weight of 309.70 g/mol. Its IUPAC name is (4R)-4-(3-ethoxy-2-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(3-ethoxy-2-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171188868 |
| Molecular Formula | C12H14ClF2NO4 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (4R)-4-(3-ethoxy-2-hydroxyphenyl)-5,5-difluoro-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CCOc1cccc([C@H]2NC(=O)OCC2(F)F)c1O.Cl |
| InChI | InChI=1S/C12H13F2NO4.ClH/c1-2-18-8-5-3-4-7(9(8)16)10-12(13,14)6-19-11(17)15-10;/h3-5,10,16H,2,6H2,1H3,(H,15,17);1H/t10-;/m1./s1 |
| InChIKey | VFHHMYWFYYRDPC-HNCPQSOCSA-N |
| XLogP | 2.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|