C26H22N2O4 — CID 10224314
2-[4-(4-tert-butylphenyl)furan-2-yl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid (PubChem CID 10224314) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenyl)furan-2-yl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid.
| Compound Name | 2-[4-(4-tert-butylphenyl)furan-2-yl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid |
|---|---|
| PubChem CID | 10224314 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[4-(4-tert-butylphenyl)furan-2-yl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(-c2coc(-c3nc4c(ccc5cc(C(=O)O)cc(O)c54)[nH]3)c2)cc1 |
| InChI | InChI=1S/C26H22N2O4/c1-26(2,3)18-7-4-14(5-8-18)17-12-21(32-13-17)24-27-19-9-6-15-10-16(25(30)31)11-20(29)22(15)23(19)28-24/h4-13,29H,1-3H3,(H,27,28)(H,30,31) |
| InChIKey | YUYKKHRGDBTSCO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |