C15H28O4Si — CID 102245347
(2S,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-methyloct-4-yn-3-one (PubChem CID 102245347) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (2S,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-methyloct-4-yn-3-one.
| Compound Name | (2S,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-methyloct-4-yn-3-one |
|---|---|
| PubChem CID | 102245347 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2S,6R,7R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2-methyloct-4-yn-3-one |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)C(=O)C#C[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C15H28O4Si/c1-11(10-19-20(6,7)15(3,4)5)13(17)8-9-14(18)12(2)16/h11-12,14,16,18H,10H2,1-7H3/t11-,12+,14+/m0/s1 |
| InChIKey | GHADGNZPDMFMKR-OUCADQQQSA-N |
| XLogP | 1.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|