C34H49N5O5 — CID 102246574
N-[4-(benzylamino)-3,4-dioxobutan-2-yl]-2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-4-methylpentanamide (PubChem CID 102246574) has the molecular formula C34H49N5O5 and a molecular weight of 607.80 g/mol. Its IUPAC name is N-[4-(benzylamino)-3,4-dioxobutan-2-yl]-2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-4-methylpentanamide.
| Compound Name | N-[4-(benzylamino)-3,4-dioxobutan-2-yl]-2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 102246574 |
| Molecular Formula | C34H49N5O5 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | N-[4-(benzylamino)-3,4-dioxobutan-2-yl]-2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-4-methylpentanamide |
| SMILES | CC(C)CCN(C(=O)CNCCC(=O)NCc1ccccc1)C(CC(C)C)C(=O)NC(C)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H49N5O5/c1-24(2)17-19-39(31(41)23-35-18-16-30(40)36-21-27-12-8-6-9-13-27)29(20-25(3)4)33(43)38-26(5)32(42)34(44)37-22-28-14-10-7-11-15-28/h6-15,24-26,29,35H,16-23H2,1-5H3,(H,36,40)(H,37,44)(H,38,43) |
| InChIKey | LUMABWXFFHODKM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|