C36H51N5O5 — CID 102246573
3-[[2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide (PubChem CID 102246573) has the molecular formula C36H51N5O5 and a molecular weight of 633.83 g/mol. Its IUPAC name is 3-[[2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide.
| Compound Name | 3-[[2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
|---|---|
| PubChem CID | 102246573 |
| Molecular Formula | C36H51N5O5 |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.39 |
| IUPAC Name | 3-[[2-[[2-[[3-(benzylamino)-3-oxopropyl]amino]acetyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
| SMILES | CC(C)CCN(C(=O)CNCCC(=O)NCc1ccccc1)C(Cc1ccccc1)C(=O)NC(C)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C36H51N5O5/c1-26(2)20-22-41(33(43)25-37-21-19-32(42)38-24-29-15-9-5-10-16-29)31(23-28-13-7-4-8-14-28)35(45)39-27(3)34(44)36(46)40-30-17-11-6-12-18-30/h4-5,7-10,13-16,26-27,30-31,37H,6,11-12,17-25H2,1-3H3,(H,38,42)(H,39,45)(H,40,46) |
| InChIKey | QQHUAGUICFFNCZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|