C35H48N4O5 — CID 102246564
3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide (PubChem CID 102246564) has the molecular formula C35H48N4O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is 3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide.
| Compound Name | 3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
|---|---|
| PubChem CID | 102246564 |
| Molecular Formula | C35H48N4O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | 3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-(3-methylbutyl)amino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N(CCC(C)C)C(Cc1ccccc1)C(=O)NC(C)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C35H48N4O5/c1-24(2)20-21-39(35(44)30(37-26(4)40)22-27-14-8-5-9-15-27)31(23-28-16-10-6-11-17-28)33(42)36-25(3)32(41)34(43)38-29-18-12-7-13-19-29/h5-6,8-11,14-17,24-25,29-31H,7,12-13,18-23H2,1-4H3,(H,36,42)(H,37,40)(H,38,43)/t25?,30-,31?/m0/s1 |
| InChIKey | ICJGGMKABCXWCG-POUISYMWSA-N |
| XLogP | 3.74 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|