C30H38N4O5 — CID 102246552
3-[[2-[(2-acetamidoacetyl)-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide (PubChem CID 102246552) has the molecular formula C30H38N4O5 and a molecular weight of 534.66 g/mol. Its IUPAC name is 3-[[2-[(2-acetamidoacetyl)-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide.
| Compound Name | 3-[[2-[(2-acetamidoacetyl)-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
|---|---|
| PubChem CID | 102246552 |
| Molecular Formula | C30H38N4O5 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 3-[[2-[(2-acetamidoacetyl)-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
| SMILES | CC(=O)NCC(=O)N(Cc1ccccc1)C(Cc1ccccc1)C(=O)NC(C)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H38N4O5/c1-21(28(37)30(39)33-25-16-10-5-11-17-25)32-29(38)26(18-23-12-6-3-7-13-23)34(27(36)19-31-22(2)35)20-24-14-8-4-9-15-24/h3-4,6-9,12-15,21,25-26H,5,10-11,16-20H2,1-2H3,(H,31,35)(H,32,38)(H,33,39) |
| InChIKey | DSEVPPJADORFQA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|