C37H44N4O5 — CID 102246560
3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide (PubChem CID 102246560) has the molecular formula C37H44N4O5 and a molecular weight of 624.78 g/mol. Its IUPAC name is 3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide.
| Compound Name | 3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
|---|---|
| PubChem CID | 102246560 |
| Molecular Formula | C37H44N4O5 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 3-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]-benzylamino]-3-phenylpropanoyl]amino]-N-cyclohexyl-2-oxobutanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N(Cc1ccccc1)C(Cc1ccccc1)C(=O)NC(C)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C37H44N4O5/c1-26(34(43)36(45)40-31-21-13-6-14-22-31)38-35(44)33(24-29-17-9-4-10-18-29)41(25-30-19-11-5-12-20-30)37(46)32(39-27(2)42)23-28-15-7-3-8-16-28/h3-5,7-12,15-20,26,31-33H,6,13-14,21-25H2,1-2H3,(H,38,44)(H,39,42)(H,40,45)/t26?,32-,33?/m0/s1 |
| InChIKey | BZYXKFILDWZMGR-KUSSWHHFSA-N |
| XLogP | 3.90 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|