About phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate
phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 102247017) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate.
Molecular Properties
| Compound Name | phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate |
| PubChem CID | 102247017 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | CC1=CC(=O)N(C(=O)Oc2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C14H15NO3/c1-10-8-11(2)15(13(16)9-10)14(17)18-12-6-4-3-5-7-12/h3-7,9,11H,8H2,1-2H3/t11-/m1/s1 |
| InChIKey | POBCCTSKHRJYOF-LLVKDONJSA-N |
| XLogP | 2.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate?
The IUPAC name of phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate (CID 102247017) is phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate.
What is the SMILES notation for phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate?
The canonical SMILES for phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate is CC1=CC(=O)N(C(=O)Oc2ccccc2)[C@H](C)C1.
What is the InChIKey of phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate?
The InChIKey is POBCCTSKHRJYOF-LLVKDONJSA-N. The full InChI is InChI=1S/C14H15NO3/c1-10-8-11(2)15(13(16)9-10)14(17)18-12-6-4-3-5-7-12/h3-7,9,11H,8H2,1-2H3/t11-/m1/s1.
What are the key properties of phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate?
phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate has a molecular weight of 245.28 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (2R)-2,4-dimethyl-6-oxo-2,3-dihydropyridine-1-carboxylate is sourced from PubChem (CID 102247017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).