C18H18N4O5 — CID 11372130
phenyl (1S,12S)-4,12-dimethyl-3,5,10-trioxo-2,4,6,13-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-13-carboxylate (PubChem CID 11372130) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is phenyl (1S,12S)-4,12-dimethyl-3,5,10-trioxo-2,4,6,13-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-13-carboxylate.
| Compound Name | phenyl (1S,12S)-4,12-dimethyl-3,5,10-trioxo-2,4,6,13-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-13-carboxylate |
|---|---|
| PubChem CID | 11372130 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | phenyl (1S,12S)-4,12-dimethyl-3,5,10-trioxo-2,4,6,13-tetrazatricyclo[7.4.0.02,6]tridec-8-ene-13-carboxylate |
| SMILES | C[C@H]1CC(=O)C2=CCn3c(=O)n(C)c(=O)n3[C@@H]2N1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H18N4O5/c1-11-10-14(23)13-8-9-20-16(24)19(2)17(25)22(20)15(13)21(11)18(26)27-12-6-4-3-5-7-12/h3-8,11,15H,9-10H2,1-2H3/t11-,15-/m0/s1 |
| InChIKey | YEGZJVMYLCLFGQ-NHYWBVRUSA-N |
| XLogP | 0.65 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |