C15H17I3NNaO3 — CID 102248370
sodium N-[3-(2-carboxybutyl)-2,4,6-triiodophenyl]butanimidate (PubChem CID 102248370) has the molecular formula C15H17I3NNaO3 and a molecular weight of 663.01 g/mol. Its IUPAC name is sodium N-[3-(2-carboxybutyl)-2,4,6-triiodophenyl]butanimidate.
| Compound Name | sodium N-[3-(2-carboxybutyl)-2,4,6-triiodophenyl]butanimidate |
|---|---|
| PubChem CID | 102248370 |
| Molecular Formula | C15H17I3NNaO3 |
| Molecular Weight | 663.01 g/mol |
| Exact Mass | 662.82 |
| IUPAC Name | sodium N-[3-(2-carboxybutyl)-2,4,6-triiodophenyl]butanimidate |
| SMILES | CCC/C([O-])=N/c1c(I)cc(I)c(CC(CC)C(=O)O)c1I.[Na+] |
| InChI | InChI=1S/C15H18I3NO3.Na/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22;/h7-8H,3-6H2,1-2H3,(H,19,20)(H,21,22);/q;+1/p-1 |
| InChIKey | KTVKGXZZBQCBGD-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.01 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|