C12H13I3N2O2 — CID 5241
3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid (PubChem CID 5241) has the molecular formula C12H13I3N2O2 and a molecular weight of 597.96 g/mol. Its IUPAC name is 3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid.
| Compound Name | 3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid |
|---|---|
| PubChem CID | 5241 |
| Molecular Formula | C12H13I3N2O2 |
| Molecular Weight | 597.96 g/mol |
| Exact Mass | 597.81 |
| IUPAC Name | 3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid |
| SMILES | CN(C)/C=N/c1c(I)cc(I)c(CCC(=O)O)c1I |
| InChI | InChI=1S/C12H13I3N2O2/c1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19/h5-6H,3-4H2,1-2H3,(H,18,19)/b16-6+ |
| InChIKey | YQNFBOJPTAXAKV-OMCISZLKSA-N |
| XLogP | 3.74 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.96 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|