About Ipodate Calcium
Ipodate Calcium (PubChem CID 14381) has the molecular formula C24H24CaI6N4O4
and a molecular weight of 1234.00 g/mol. Its IUPAC name is calcium bis(3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoate).
Molecular Properties
| Compound Name | Ipodate Calcium |
| PubChem CID | 14381 |
| Molecular Formula | C24H24CaI6N4O4 |
| Molecular Weight | 1234.00 g/mol |
| Exact Mass | 1233.57 |
| IUPAC Name | calcium bis(3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoate) |
| SMILES | CN(C)C=NC1=C(C=C(C(=C1I)CCC(=O)[O-])I)I.CN(C)C=NC1=C(C=C(C(=C1I)CCC(=O)[O-])I)I.[Ca+2] |
| InChI | InChI=1S/2C12H13I3N2O2.Ca/c2*1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19;/h2*5-6H,3-4H2,1-2H3,(H,18,19);/q;;+2/p-2 |
| InChIKey | HVZGHKKROPCBDE-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | 333 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1234.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze Ipodate Calcium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ipodate Calcium?
The IUPAC name of Ipodate Calcium (CID 14381) is calcium bis(3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoate).
What is the SMILES notation for Ipodate Calcium?
The canonical SMILES for Ipodate Calcium is CN(C)C=NC1=C(C=C(C(=C1I)CCC(=O)[O-])I)I.CN(C)C=NC1=C(C=C(C(=C1I)CCC(=O)[O-])I)I.[Ca+2].
What is the InChIKey of Ipodate Calcium?
The InChIKey is HVZGHKKROPCBDE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H13I3N2O2.Ca/c2*1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19;/h2*5-6H,3-4H2,1-2H3,(H,18,19);/q;;+2/p-2.
What are the key properties of Ipodate Calcium?
Ipodate Calcium has a molecular weight of 1234.00 g/mol, XLogP of not available, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Ipodate Calcium is sourced from PubChem (CID 14381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).