C24H24CaI6N4O4 — CID 23617397
calcium bis(3-(dimethylaminomethylideneamino)-3-(2,4,6-triiodophenyl)propanoate) (PubChem CID 23617397) has the molecular formula C24H24CaI6N4O4 and a molecular weight of 1233.98 g/mol. Its IUPAC name is calcium bis(3-(dimethylaminomethylideneamino)-3-(2,4,6-triiodophenyl)propanoate).
| Compound Name | calcium bis(3-(dimethylaminomethylideneamino)-3-(2,4,6-triiodophenyl)propanoate) |
|---|---|
| PubChem CID | 23617397 |
| Molecular Formula | C24H24CaI6N4O4 |
| Molecular Weight | 1233.98 g/mol |
| Exact Mass | 1233.57 |
| IUPAC Name | calcium bis(3-(dimethylaminomethylideneamino)-3-(2,4,6-triiodophenyl)propanoate) |
| SMILES | CN(C)/C=N/C(CC(=O)[O-])c1c(I)cc(I)cc1I.CN(C)/C=N/C(CC(=O)[O-])c1c(I)cc(I)cc1I.[Ca+2] |
| InChI | InChI=1S/2C12H13I3N2O2.Ca/c2*1-17(2)6-16-10(5-11(18)19)12-8(14)3-7(13)4-9(12)15;/h2*3-4,6,10H,5H2,1-2H3,(H,18,19);/q;;+2/p-2/b2*16-6+; |
| InChIKey | OLHVTBGHRZPCAW-HZIJXFFPSA-L |
| XLogP | 4.16 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1233.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|