C6H13NS — CID 102249013
1-ethylsulfanyl-N,N-dimethylethenamine (PubChem CID 102249013) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is 1-ethylsulfanyl-N,N-dimethylethenamine.
| Compound Name | 1-ethylsulfanyl-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 102249013 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 1-ethylsulfanyl-N,N-dimethylethenamine |
| SMILES | C=C(SCC)N(C)C |
| InChI | InChI=1S/C6H13NS/c1-5-8-6(2)7(3)4/h2,5H2,1,3-4H3 |
| InChIKey | VNANYGAKQHPRBR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |