About (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine
(E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine (PubChem CID 134923137) has the molecular formula C6H13NS2
and a molecular weight of 163.31 g/mol. Its IUPAC name is (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine.
Analyze (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine?
The IUPAC name of (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine (CID 134923137) is (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine.
What is the SMILES notation for (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine?
The canonical SMILES for (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine is CS/C=C(/SC)N(C)C.
What is the InChIKey of (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine?
The InChIKey is MAJRLMJHSGGUKU-AATRIKPKSA-N. The full InChI is InChI=1S/C6H13NS2/c1-7(2)6(9-4)5-8-3/h5H,1-4H3/b6-5+.
What are the key properties of (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine?
(E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine has a molecular weight of 163.31 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-1,2-bis(methylsulfanyl)ethenamine is sourced from PubChem (CID 134923137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).