C7H15NS — CID 142051117
N,N-dimethyl-1-propylsulfanylethenamine (PubChem CID 142051117) has the molecular formula C7H15NS and a molecular weight of 145.27 g/mol. Its IUPAC name is N,N-dimethyl-1-propylsulfanylethenamine.
| Compound Name | N,N-dimethyl-1-propylsulfanylethenamine |
|---|---|
| PubChem CID | 142051117 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | N,N-dimethyl-1-propylsulfanylethenamine |
| SMILES | C=C(SCCC)N(C)C |
| InChI | InChI=1S/C7H15NS/c1-5-6-9-7(2)8(3)4/h2,5-6H2,1,3-4H3 |
| InChIKey | YNSRZSYNQQBRRV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |