About 1-butylsulfanyl-N-ethyl-N-methylethenamine
1-butylsulfanyl-N-ethyl-N-methylethenamine (PubChem CID 142050758) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is 1-butylsulfanyl-N-ethyl-N-methylethenamine.
Molecular Properties
| Compound Name | 1-butylsulfanyl-N-ethyl-N-methylethenamine |
| PubChem CID | 142050758 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-butylsulfanyl-N-ethyl-N-methylethenamine |
| SMILES | C=C(SCCCC)N(C)CC |
| InChI | InChI=1S/C9H19NS/c1-5-7-8-11-9(3)10(4)6-2/h3,5-8H2,1-2,4H3 |
| InChIKey | SKNIBJYLTDTKQG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanyl-N-ethyl-N-methylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanyl-N-ethyl-N-methylethenamine?
The IUPAC name of 1-butylsulfanyl-N-ethyl-N-methylethenamine (CID 142050758) is 1-butylsulfanyl-N-ethyl-N-methylethenamine.
What is the SMILES notation for 1-butylsulfanyl-N-ethyl-N-methylethenamine?
The canonical SMILES for 1-butylsulfanyl-N-ethyl-N-methylethenamine is C=C(SCCCC)N(C)CC.
What is the InChIKey of 1-butylsulfanyl-N-ethyl-N-methylethenamine?
The InChIKey is SKNIBJYLTDTKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS/c1-5-7-8-11-9(3)10(4)6-2/h3,5-8H2,1-2,4H3.
What are the key properties of 1-butylsulfanyl-N-ethyl-N-methylethenamine?
1-butylsulfanyl-N-ethyl-N-methylethenamine has a molecular weight of 173.32 g/mol, XLogP of 2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanyl-N-ethyl-N-methylethenamine is sourced from PubChem (CID 142050758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).