About 3-methyl-2-methylidene-1,3-thiazole-4-thiol
3-methyl-2-methylidene-1,3-thiazole-4-thiol (PubChem CID 151923659) has the molecular formula C5H7NS2
and a molecular weight of 145.25 g/mol. Its IUPAC name is 3-methyl-2-methylidene-1,3-thiazole-4-thiol.
Molecular Properties
| Compound Name | 3-methyl-2-methylidene-1,3-thiazole-4-thiol |
| PubChem CID | 151923659 |
| Molecular Formula | C5H7NS2 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.00 |
| IUPAC Name | 3-methyl-2-methylidene-1,3-thiazole-4-thiol |
| SMILES | C=C1SC=C(S)N1C |
| InChI | InChI=1S/C5H7NS2/c1-4-6(2)5(7)3-8-4/h3,7H,1H2,2H3 |
| InChIKey | SXHIWARVHWOAHI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-methylidene-1,3-thiazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-methylidene-1,3-thiazole-4-thiol?
The IUPAC name of 3-methyl-2-methylidene-1,3-thiazole-4-thiol (CID 151923659) is 3-methyl-2-methylidene-1,3-thiazole-4-thiol.
What is the SMILES notation for 3-methyl-2-methylidene-1,3-thiazole-4-thiol?
The canonical SMILES for 3-methyl-2-methylidene-1,3-thiazole-4-thiol is C=C1SC=C(S)N1C.
What is the InChIKey of 3-methyl-2-methylidene-1,3-thiazole-4-thiol?
The InChIKey is SXHIWARVHWOAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS2/c1-4-6(2)5(7)3-8-4/h3,7H,1H2,2H3.
What are the key properties of 3-methyl-2-methylidene-1,3-thiazole-4-thiol?
3-methyl-2-methylidene-1,3-thiazole-4-thiol has a molecular weight of 145.25 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-methylidene-1,3-thiazole-4-thiol is sourced from PubChem (CID 151923659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).