C18H15F6N3O3 — CID 10224921
4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(1-oxidopyridin-1-ium-2-yl)imidazolidin-2-one (PubChem CID 10224921) has the molecular formula C18H15F6N3O3 and a molecular weight of 435.32 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(1-oxidopyridin-1-ium-2-yl)imidazolidin-2-one.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(1-oxidopyridin-1-ium-2-yl)imidazolidin-2-one |
|---|---|
| PubChem CID | 10224921 |
| Molecular Formula | C18H15F6N3O3 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(1-oxidopyridin-1-ium-2-yl)imidazolidin-2-one |
| SMILES | O=C1NCC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cccc[n+]2[O-])N1 |
| InChI | InChI=1S/C18H15F6N3O3/c19-17(20,21)12-5-11(6-13(7-12)18(22,23)24)8-30-10-16(9-25-15(28)26-16)14-3-1-2-4-27(14)29/h1-7H,8-10H2,(H2,25,26,28) |
| InChIKey | UVRARECNYVVGJR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|