C37H29N3O11 — CID 102250450
[(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(2-nitroimidazol-1-yl)oxan-2-yl]methyl benzoate (PubChem CID 102250450) has the molecular formula C37H29N3O11 and a molecular weight of 691.65 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(2-nitroimidazol-1-yl)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(2-nitroimidazol-1-yl)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102250450 |
| Molecular Formula | C37H29N3O11 |
| Molecular Weight | 691.65 g/mol |
| Exact Mass | 691.18 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(2-nitroimidazol-1-yl)oxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](n2ccnc2[N+](=O)[O-])[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H29N3O11/c41-33(24-13-5-1-6-14-24)47-23-28-29(49-34(42)25-15-7-2-8-16-25)30(50-35(43)26-17-9-3-10-18-26)31(51-36(44)27-19-11-4-12-20-27)32(48-28)39-22-21-38-37(39)40(45)46/h1-22,28-32H,23H2/t28-,29+,30+,31-,32+/m1/s1 |
| InChIKey | HEMRKVSWSQDNNY-MQSWGENCSA-N |
| XLogP | 5.22 |
| TPSA | 175.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|