C22H34N6O7S — CID 102250477
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[[2-[2-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]ethylamino]acetyl]amino]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 102250477) has the molecular formula C22H34N6O7S and a molecular weight of 526.62 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[[2-[2-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]ethylamino]acetyl]amino]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[[2-[2-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]ethylamino]acetyl]amino]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 102250477 |
| Molecular Formula | C22H34N6O7S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[[2-[2-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]ethylamino]acetyl]amino]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCNC(=O)CNCC[C@H]1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C22H34N6O7S/c29-17(4-8-28-19(31)1-2-20(28)32)24-6-9-34-11-12-35-10-7-25-18(30)13-23-5-3-16-21-15(14-36-16)26-22(33)27-21/h1-2,15-16,21,23H,3-14H2,(H,24,29)(H,25,30)(H2,26,27,33)/t15?,16-,21?/m1/s1 |
| InChIKey | SPNFYENTCWTOGR-ZGOJQLDESA-N |
| XLogP | -2.29 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|