C20H29BrN4O6S — CID 86668288
N-[2-[2-[2-(3-bromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 86668288) has the molecular formula C20H29BrN4O6S and a molecular weight of 533.45 g/mol. Its IUPAC name is N-[2-[2-[2-(3-bromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[2-[2-(3-bromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 86668288 |
| Molecular Formula | C20H29BrN4O6S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | N-[2-[2-[2-(3-bromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCN1C(=O)C=C(Br)C1=O |
| InChI | InChI=1S/C20H29BrN4O6S/c21-13-11-17(27)25(19(13)28)6-8-31-10-9-30-7-5-22-16(26)4-2-1-3-15-18-14(12-32-15)23-20(29)24-18/h11,14-15,18H,1-10,12H2,(H,22,26)(H2,23,24,29) |
| InChIKey | MTTOPEXTIJUGOO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|