C28H41NO3Si — CID 102250857
(3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyazonan-2-one (PubChem CID 102250857) has the molecular formula C28H41NO3Si and a molecular weight of 467.73 g/mol. Its IUPAC name is (3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyazonan-2-one.
| Compound Name | (3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyazonan-2-one |
|---|---|
| PubChem CID | 102250857 |
| Molecular Formula | C28H41NO3Si |
| Molecular Weight | 467.73 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyazonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@@H](OCc2ccccc2)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C28H41NO3Si/c1-28(2,3)33(4,5)32-25-18-12-13-19-26(31-22-24-16-10-7-11-17-24)27(30)29(21-25)20-23-14-8-6-9-15-23/h6-11,14-17,25-26H,12-13,18-22H2,1-5H3/t25-,26-/m1/s1 |
| InChIKey | HPVZQYVAWAICRW-CLJLJLNGSA-N |
| XLogP | 6.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|