C21H34ClNO2Si — CID 102250858
(3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloroazonan-2-one (PubChem CID 102250858) has the molecular formula C21H34ClNO2Si and a molecular weight of 396.05 g/mol. Its IUPAC name is (3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloroazonan-2-one.
| Compound Name | (3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloroazonan-2-one |
|---|---|
| PubChem CID | 102250858 |
| Molecular Formula | C21H34ClNO2Si |
| Molecular Weight | 396.05 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (3R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloroazonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@@H](Cl)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H34ClNO2Si/c1-21(2,3)26(4,5)25-18-13-9-10-14-19(22)20(24)23(16-18)15-17-11-7-6-8-12-17/h6-8,11-12,18-19H,9-10,13-16H2,1-5H3/t18-,19-/m1/s1 |
| InChIKey | ONKYYGHWKRTEJE-RTBURBONSA-N |
| XLogP | 5.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.05 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|